C21H39NO4 — CID 87521566
(propanoylamino) (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 87521566) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is (propanoylamino) (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | (propanoylamino) (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 87521566 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | (propanoylamino) (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)ONC(=O)CC |
| InChI | InChI=1S/C21H39NO4/c1-3-5-6-13-16-19(23)17-14-11-9-7-8-10-12-15-18-21(25)26-22-20(24)4-2/h11,14,19,23H,3-10,12-13,15-18H2,1-2H3,(H,22,24)/b14-11-/t19-/m1/s1 |
| InChIKey | HMFSECCXLOPZBI-KWRJMZDGSA-N |
| XLogP | 4.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|