C24H32ClN3OS — CID 87521783
1-[4-[6-(but-3-enylamino)hexoxy]phenyl]-3-(4-chlorophenyl)-1-methylthiourea (PubChem CID 87521783) has the molecular formula C24H32ClN3OS and a molecular weight of 446.06 g/mol. Its IUPAC name is 1-[4-[6-(but-3-enylamino)hexoxy]phenyl]-3-(4-chlorophenyl)-1-methylthiourea.
| Compound Name | 1-[4-[6-(but-3-enylamino)hexoxy]phenyl]-3-(4-chlorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 87521783 |
| Molecular Formula | C24H32ClN3OS |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 1-[4-[6-(but-3-enylamino)hexoxy]phenyl]-3-(4-chlorophenyl)-1-methylthiourea |
| SMILES | C=CCCNCCCCCCOc1ccc(N(C)C(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H32ClN3OS/c1-3-4-17-26-18-7-5-6-8-19-29-23-15-13-22(14-16-23)28(2)24(30)27-21-11-9-20(25)10-12-21/h3,9-16,26H,1,4-8,17-19H2,2H3,(H,27,30) |
| InChIKey | KCAQROJFZGLZQP-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|