C28H28FN3O4 — CID 87522034
(2S)-4-[[2-fluoro-5-[3-[[(3-formylbenzoyl)amino]methyl]phenyl]phenyl]methyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 87522034) has the molecular formula C28H28FN3O4 and a molecular weight of 489.55 g/mol. Its IUPAC name is (2S)-4-[[2-fluoro-5-[3-[[(3-formylbenzoyl)amino]methyl]phenyl]phenyl]methyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[[2-fluoro-5-[3-[[(3-formylbenzoyl)amino]methyl]phenyl]phenyl]methyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87522034 |
| Molecular Formula | C28H28FN3O4 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (2S)-4-[[2-fluoro-5-[3-[[(3-formylbenzoyl)amino]methyl]phenyl]phenyl]methyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(Cc2cc(-c3cccc(CNC(=O)c4cccc(C=O)c4)c3)ccc2F)CCN1C(=O)O |
| InChI | InChI=1S/C28H28FN3O4/c1-19-16-31(10-11-32(19)28(35)36)17-25-14-23(8-9-26(25)29)22-6-2-4-20(12-22)15-30-27(34)24-7-3-5-21(13-24)18-33/h2-9,12-14,18-19H,10-11,15-17H2,1H3,(H,30,34)(H,35,36)/t19-/m0/s1 |
| InChIKey | IVKUDCPOWXJYRC-IBGZPJMESA-N |
| XLogP | 4.42 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|