C8H7NO4S2 — CID 87522048
5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonic acid (PubChem CID 87522048) has the molecular formula C8H7NO4S2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonic acid.
| Compound Name | 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 87522048 |
| Molecular Formula | C8H7NO4S2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 5-(3-methyl-1,2-oxazol-5-yl)thiophene-2-sulfonic acid |
| SMILES | Cc1cc(-c2ccc(S(=O)(=O)O)s2)on1 |
| InChI | InChI=1S/C8H7NO4S2/c1-5-4-6(13-9-5)7-2-3-8(14-7)15(10,11)12/h2-4H,1H3,(H,10,11,12) |
| InChIKey | ZIPDLDQGUAAXSW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|