C8H9N3O3S3 — CID 2822907
5-(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)thiophene-2-sulfonic acid (PubChem CID 2822907) has the molecular formula C8H9N3O3S3 and a molecular weight of 291.38 g/mol. Its IUPAC name is 5-(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)thiophene-2-sulfonic acid.
| Compound Name | 5-(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 2822907 |
| Molecular Formula | C8H9N3O3S3 |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 290.98 |
| IUPAC Name | 5-(4-methyl-5-methylsulfanyl-1,2,4-triazol-3-yl)thiophene-2-sulfonic acid |
| SMILES | CSc1nnc(-c2ccc(S(=O)(=O)O)s2)n1C |
| InChI | InChI=1S/C8H9N3O3S3/c1-11-7(9-10-8(11)15-2)5-3-4-6(16-5)17(12,13)14/h3-4H,1-2H3,(H,12,13,14) |
| InChIKey | STNGQKUJBWDQHK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|