C18H35O10P — CID 87522475
[1-[(2R)-2,3-di(hexanoyloxy)propoxy]-2,3-dihydroxypropyl]phosphonic acid (PubChem CID 87522475) has the molecular formula C18H35O10P and a molecular weight of 442.44 g/mol. Its IUPAC name is [1-[(2R)-2,3-di(hexanoyloxy)propoxy]-2,3-dihydroxypropyl]phosphonic acid.
| Compound Name | [1-[(2R)-2,3-di(hexanoyloxy)propoxy]-2,3-dihydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 87522475 |
| Molecular Formula | C18H35O10P |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [1-[(2R)-2,3-di(hexanoyloxy)propoxy]-2,3-dihydroxypropyl]phosphonic acid |
| SMILES | CCCCCC(=O)OC[C@H](COC(C(O)CO)P(=O)(O)O)OC(=O)CCCCC |
| InChI | InChI=1S/C18H35O10P/c1-3-5-7-9-16(21)26-12-14(28-17(22)10-8-6-4-2)13-27-18(15(20)11-19)29(23,24)25/h14-15,18-20H,3-13H2,1-2H3,(H2,23,24,25)/t14-,15?,18?/m1/s1 |
| InChIKey | SOTWYZOANQNUSI-KSTDHSDQSA-N |
| XLogP | 1.48 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|