C21H19N3O4S — CID 87527344
[3-amino-5-(3,4-dimethoxyanilino)-4-isocyanothiophen-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 87527344) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is [3-amino-5-(3,4-dimethoxyanilino)-4-isocyanothiophen-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [3-amino-5-(3,4-dimethoxyanilino)-4-isocyanothiophen-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 87527344 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [3-amino-5-(3,4-dimethoxyanilino)-4-isocyanothiophen-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | [C-]#[N+]c1c(Nc2ccc(OC)c(OC)c2)sc(C(=O)c2ccc(OC)cc2)c1N |
| InChI | InChI=1S/C21H19N3O4S/c1-23-18-17(22)20(19(25)12-5-8-14(26-2)9-6-12)29-21(18)24-13-7-10-15(27-3)16(11-13)28-4/h5-11,24H,22H2,2-4H3 |
| InChIKey | MJELRJMKVCEBEM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|