About [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone
[3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 141278039) has the molecular formula C20H20N2O4S
and a molecular weight of 384.46 g/mol. Its IUPAC name is [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone.
Molecular Properties
| Compound Name | [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone |
| PubChem CID | 141278039 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2sc(Nc3ccc(OC)cc3OC)cc2N)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-24-13-6-4-12(5-7-13)19(23)20-15(21)11-18(27-20)22-16-9-8-14(25-2)10-17(16)26-3/h4-11,22H,21H2,1-3H3 |
| InChIKey | HYYDWMGLJVIGRL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone?
The IUPAC name of [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone (CID 141278039) is [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone.
What is the SMILES notation for [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone?
The canonical SMILES for [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone is COc1ccc(C(=O)c2sc(Nc3ccc(OC)cc3OC)cc2N)cc1.
What is the InChIKey of [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone?
The InChIKey is HYYDWMGLJVIGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4S/c1-24-13-6-4-12(5-7-13)19(23)20-15(21)11-18(27-20)22-16-9-8-14(25-2)10-17(16)26-3/h4-11,22H,21H2,1-3H3.
What are the key properties of [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone?
[3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone has a molecular weight of 384.46 g/mol, XLogP of 4.33, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-5-(2,4-dimethoxyanilino)thiophen-2-yl]-(4-methoxyphenyl)methanone is sourced from PubChem (CID 141278039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).