C14H28O3S — CID 87527626
1,2-bis(2-methylpropyl)cyclohexane-1-sulfonic acid (PubChem CID 87527626) has the molecular formula C14H28O3S and a molecular weight of 276.44 g/mol. Its IUPAC name is 1,2-bis(2-methylpropyl)cyclohexane-1-sulfonic acid.
| Compound Name | 1,2-bis(2-methylpropyl)cyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 87527626 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1,2-bis(2-methylpropyl)cyclohexane-1-sulfonic acid |
| SMILES | CC(C)CC1CCCCC1(CC(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C14H28O3S/c1-11(2)9-13-7-5-6-8-14(13,10-12(3)4)18(15,16)17/h11-13H,5-10H2,1-4H3,(H,15,16,17) |
| InChIKey | QDJHZVFPZIXATE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|