C15H18ClN5O — CID 87531774
2-amino-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carbonyl chloride (PubChem CID 87531774) has the molecular formula C15H18ClN5O and a molecular weight of 319.80 g/mol. Its IUPAC name is 2-amino-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carbonyl chloride.
| Compound Name | 2-amino-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 87531774 |
| Molecular Formula | C15H18ClN5O |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-amino-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carbonyl chloride |
| SMILES | CN1CCC(c2[nH]ncc2-c2cnc(N)c(C(=O)Cl)c2)CC1 |
| InChI | InChI=1S/C15H18ClN5O/c1-21-4-2-9(3-5-21)13-12(8-19-20-13)10-6-11(14(16)22)15(17)18-7-10/h6-9H,2-5H2,1H3,(H2,17,18)(H,19,20) |
| InChIKey | QXOKGLHGYJLOFZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|