C22H26N6O3 — CID 68654839
2-amino-N-(2-hydroxy-5-methoxyphenyl)-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carboxamide (PubChem CID 68654839) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-amino-N-(2-hydroxy-5-methoxyphenyl)-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-amino-N-(2-hydroxy-5-methoxyphenyl)-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68654839 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-amino-N-(2-hydroxy-5-methoxyphenyl)-5-[5-(1-methylpiperidin-4-yl)-1H-pyrazol-4-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(O)c(NC(=O)c2cc(-c3cn[nH]c3C3CCN(C)CC3)cnc2N)c1 |
| InChI | InChI=1S/C22H26N6O3/c1-28-7-5-13(6-8-28)20-17(12-25-27-20)14-9-16(21(23)24-11-14)22(30)26-18-10-15(31-2)3-4-19(18)29/h3-4,9-13,29H,5-8H2,1-2H3,(H2,23,24)(H,25,27)(H,26,30) |
| InChIKey | XJGWMWAUJQAMIQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|