C22H23NO3S — CID 87531875
(2S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,2-dimethylpyrrolidine-2-carbothioic S-acid (PubChem CID 87531875) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is (2S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,2-dimethylpyrrolidine-2-carbothioic S-acid.
| Compound Name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,2-dimethylpyrrolidine-2-carbothioic S-acid |
|---|---|
| PubChem CID | 87531875 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonyl)-1,2-dimethylpyrrolidine-2-carbothioic S-acid |
| SMILES | CN1CCC(C(=O)OCC2c3ccccc3-c3ccccc32)[C@@]1(C)C(=O)S |
| InChI | InChI=1S/C22H23NO3S/c1-22(21(25)27)19(11-12-23(22)2)20(24)26-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-19H,11-13H2,1-2H3,(H,25,27)/t19?,22-/m0/s1 |
| InChIKey | BIVPHUXWRMFMMW-BPARTEKVSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|