C11H17N3O8PSe — CID 87532071
CID 87532071 (PubChem CID 87532071) has the molecular formula C11H17N3O8PSe and a molecular weight of 429.20 g/mol.
| Compound Name | CID 87532071 |
|---|---|
| PubChem CID | 87532071 |
| Molecular Formula | C11H17N3O8PSe |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | — |
| SMILES | CNCc1cn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c([Se])nc1=O |
| InChI | InChI=1S/C11H17N3O8PSe/c1-12-2-5-3-14(11(24)13-9(5)17)10-8(16)7(15)6(22-10)4-21-23(18,19)20/h3,6-8,10,12,15-16H,2,4H2,1H3,(H2,18,19,20)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | NBQKMYOIAZVHHH-FDDDBJFASA-N |
| XLogP | -3.52 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|