C16H13F2NO2S — CID 87533070
3-fluoro-4-(3-fluoro-4-phenylmethoxyphenoxy)-2H-1,3-thiazole (PubChem CID 87533070) has the molecular formula C16H13F2NO2S and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-fluoro-4-(3-fluoro-4-phenylmethoxyphenoxy)-2H-1,3-thiazole.
| Compound Name | 3-fluoro-4-(3-fluoro-4-phenylmethoxyphenoxy)-2H-1,3-thiazole |
|---|---|
| PubChem CID | 87533070 |
| Molecular Formula | C16H13F2NO2S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-fluoro-4-(3-fluoro-4-phenylmethoxyphenoxy)-2H-1,3-thiazole |
| SMILES | Fc1cc(OC2=CSCN2F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H13F2NO2S/c17-14-8-13(21-16-10-22-11-19(16)18)6-7-15(14)20-9-12-4-2-1-3-5-12/h1-8,10H,9,11H2 |
| InChIKey | BNXHAXNTXDVPAH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|