C6H12N2OS — CID 87536382
(2R,4R)-4-methoxypyrrolidine-2-carbothioamide (PubChem CID 87536382) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is (2R,4R)-4-methoxypyrrolidine-2-carbothioamide.
| Compound Name | (2R,4R)-4-methoxypyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 87536382 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2R,4R)-4-methoxypyrrolidine-2-carbothioamide |
| SMILES | CO[C@H]1CN[C@@H](C(N)=S)C1 |
| InChI | InChI=1S/C6H12N2OS/c1-9-4-2-5(6(7)10)8-3-4/h4-5,8H,2-3H2,1H3,(H2,7,10)/t4-,5-/m1/s1 |
| InChIKey | IKXFJZZLEDMESJ-RFZPGFLSSA-N |
| XLogP | -0.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|