C16H22N2O5Si — CID 87536649
1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(Z)-2-trimethylsilylbut-1-en-3-ynyl]pyrimidine-2,4-dione (PubChem CID 87536649) has the molecular formula C16H22N2O5Si and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(Z)-2-trimethylsilylbut-1-en-3-ynyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(Z)-2-trimethylsilylbut-1-en-3-ynyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 87536649 |
| Molecular Formula | C16H22N2O5Si |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-[(2S,5S)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(Z)-2-trimethylsilylbut-1-en-3-ynyl]pyrimidine-2,4-dione |
| SMILES | C#C/C(=C/c1cn([C@@H]2CC(O)[C@H](CO)O2)c(=O)[nH]c1=O)[Si](C)(C)C |
| InChI | InChI=1S/C16H22N2O5Si/c1-5-11(24(2,3)4)6-10-8-18(16(22)17-15(10)21)14-7-12(20)13(9-19)23-14/h1,6,8,12-14,19-20H,7,9H2,2-4H3,(H,17,21,22)/b11-6-/t12?,13-,14-/m0/s1 |
| InChIKey | QSNXKQFNOCXDOP-SDLNCBIMSA-N |
| XLogP | 0.07 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|