C8H14N2O — CID 87537827
N-(1-aminoprop-2-enyl)-N,2-dimethylprop-2-enamide (PubChem CID 87537827) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(1-aminoprop-2-enyl)-N,2-dimethylprop-2-enamide.
| Compound Name | N-(1-aminoprop-2-enyl)-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 87537827 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(1-aminoprop-2-enyl)-N,2-dimethylprop-2-enamide |
| SMILES | C=CC(N)N(C)C(=O)C(=C)C |
| InChI | InChI=1S/C8H14N2O/c1-5-7(9)10(4)8(11)6(2)3/h5,7H,1-2,9H2,3-4H3 |
| InChIKey | BONCIRUFQGVZSV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|