C10H14F6N2O5 — CID 87542709
piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87542709) has the molecular formula C10H14F6N2O5 and a molecular weight of 356.22 g/mol. Its IUPAC name is piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87542709 |
| Molecular Formula | C10H14F6N2O5 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | piperidine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(=O)C1CCNCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H12N2O.2C2HF3O2/c7-6(9)5-1-3-8-4-2-5;2*3-2(4,5)1(6)7/h5,8H,1-4H2,(H2,7,9);2*(H,6,7) |
| InChIKey | YYMHFFSHRVUCDU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |