C18H22N4O4 — CID 8754555
methyl 1-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]piperidine-4-carboxylate (PubChem CID 8754555) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is methyl 1-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 8754555 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl 1-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2nc3ccccc3c(=O)n2CC(N)=O)CC1 |
| InChI | InChI=1S/C18H22N4O4/c1-26-18(25)12-6-8-21(9-7-12)11-16-20-14-5-3-2-4-13(14)17(24)22(16)10-15(19)23/h2-5,12H,6-11H2,1H3,(H2,19,23) |
| InChIKey | GJCKDWDMLNFENS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |