C19H27N4O2+ — CID 8558706
[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl-cyclooctylazanium (PubChem CID 8558706) has the molecular formula C19H27N4O2+ and a molecular weight of 343.45 g/mol. Its IUPAC name is [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl-cyclooctylazanium.
| Compound Name | [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl-cyclooctylazanium |
|---|---|
| PubChem CID | 8558706 |
| Molecular Formula | C19H27N4O2+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl-cyclooctylazanium |
| SMILES | NC(=O)Cn1c(C[NH2+]C2CCCCCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H26N4O2/c20-17(24)13-23-18(12-21-14-8-4-2-1-3-5-9-14)22-16-11-7-6-10-15(16)19(23)25/h6-7,10-11,14,21H,1-5,8-9,12-13H2,(H2,20,24)/p+1 |
| InChIKey | HBIAYXCUIRANLH-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |