C21H27N4O2+ — CID 7614296
1-adamantyl-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]azanium (PubChem CID 7614296) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-adamantyl-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]azanium.
| Compound Name | 1-adamantyl-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 7614296 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-adamantyl-[[3-(2-amino-2-oxoethyl)-4-oxoquinazolin-2-yl]methyl]azanium |
| SMILES | NC(=O)Cn1c(C[NH2+]C23CC4CC(CC(C4)C2)C3)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H26N4O2/c22-18(26)12-25-19(24-17-4-2-1-3-16(17)20(25)27)11-23-21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,13-15,23H,5-12H2,(H2,22,26)/p+1 |
| InChIKey | HGYODPJGMAKWSW-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |