C35H39F6N5O6 — CID 87547084
5-[(2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carbonyl]oxypentanoic acid (PubChem CID 87547084) has the molecular formula C35H39F6N5O6 and a molecular weight of 739.71 g/mol. Its IUPAC name is 5-[(2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carbonyl]oxypentanoic acid.
| Compound Name | 5-[(2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carbonyl]oxypentanoic acid |
|---|---|
| PubChem CID | 87547084 |
| Molecular Formula | C35H39F6N5O6 |
| Molecular Weight | 739.71 g/mol |
| Exact Mass | 739.28 |
| IUPAC Name | 5-[(2R,4S)-4-[[3-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-morpholin-4-yl-2-pyridinyl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carbonyl]oxypentanoic acid |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(N3CCOCC3)cc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2nc(OC)ccc2N1C(=O)OCCCCC(=O)O |
| InChI | InChI=1S/C35H39F6N5O6/c1-3-25-19-27(31-28(7-8-29(44-31)50-2)46(25)33(49)52-11-5-4-6-30(47)48)43-32-22(17-26(20-42-32)45-9-12-51-13-10-45)14-21-15-23(34(36,37)38)18-24(16-21)35(39,40)41/h7-8,15-18,20,25,27H,3-6,9-14,19H2,1-2H3,(H,42,43)(H,47,48)/t25-,27+/m1/s1 |
| InChIKey | CGWAVDVPWZXODZ-VPUSJEBWSA-N |
| XLogP | 7.48 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|