C13H25N3O4 — CID 87547588
butyl N-[2-[(2E)-2-butylidenehydrazinyl]-1-ethoxy-2-oxoethyl]carbamate (PubChem CID 87547588) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is butyl N-[2-[(2E)-2-butylidenehydrazinyl]-1-ethoxy-2-oxoethyl]carbamate.
| Compound Name | butyl N-[2-[(2E)-2-butylidenehydrazinyl]-1-ethoxy-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 87547588 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | butyl N-[2-[(2E)-2-butylidenehydrazinyl]-1-ethoxy-2-oxoethyl]carbamate |
| SMILES | CCC/C=N/NC(=O)C(NC(=O)OCCCC)OCC |
| InChI | InChI=1S/C13H25N3O4/c1-4-7-9-14-16-11(17)12(19-6-3)15-13(18)20-10-8-5-2/h9,12H,4-8,10H2,1-3H3,(H,15,18)(H,16,17)/b14-9+ |
| InChIKey | PGGRZEIFBYXPPG-NTEUORMPSA-N |
| XLogP | 1.78 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|