C25H23FN4O4S — CID 87548840
formyl 1-[[4-[5-[cyclopropylmethyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]methyl]azetidine-3-carboxylate (PubChem CID 87548840) has the molecular formula C25H23FN4O4S and a molecular weight of 494.55 g/mol. Its IUPAC name is formyl 1-[[4-[5-[cyclopropylmethyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]methyl]azetidine-3-carboxylate.
| Compound Name | formyl 1-[[4-[5-[cyclopropylmethyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]methyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 87548840 |
| Molecular Formula | C25H23FN4O4S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | formyl 1-[[4-[5-[cyclopropylmethyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]methyl]azetidine-3-carboxylate |
| SMILES | O=COC(=O)C1CN(Cc2ccc(-c3nnc(N(CC4CC4)C(=O)c4ccccc4F)s3)cc2)C1 |
| InChI | InChI=1S/C25H23FN4O4S/c26-21-4-2-1-3-20(21)23(32)30(12-17-5-6-17)25-28-27-22(35-25)18-9-7-16(8-10-18)11-29-13-19(14-29)24(33)34-15-31/h1-4,7-10,15,17,19H,5-6,11-14H2 |
| InChIKey | FYTSZLPISPYSKP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|