C23H25FN4O3S — CID 174634907
2-[2-[4-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]ethylamino]acetic acid (PubChem CID 174634907) has the molecular formula C23H25FN4O3S and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[2-[4-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]ethylamino]acetic acid.
| Compound Name | 2-[2-[4-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]ethylamino]acetic acid |
|---|---|
| PubChem CID | 174634907 |
| Molecular Formula | C23H25FN4O3S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-[2-[4-[5-[butyl-(2-fluorobenzoyl)amino]-1,3,4-thiadiazol-2-yl]phenyl]ethylamino]acetic acid |
| SMILES | CCCCN(C(=O)c1ccccc1F)c1nnc(-c2ccc(CCNCC(=O)O)cc2)s1 |
| InChI | InChI=1S/C23H25FN4O3S/c1-2-3-14-28(22(31)18-6-4-5-7-19(18)24)23-27-26-21(32-23)17-10-8-16(9-11-17)12-13-25-15-20(29)30/h4-11,25H,2-3,12-15H2,1H3,(H,29,30) |
| InChIKey | QUITXYYQJPSQMR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|