C26H33FN8O2S — CID 123776091
N-butyl-N-[5-[4-[2-(3,3-dihydrazinylprop-2-enylideneamino)ethoxy]-3,5-dimethylphenyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide (PubChem CID 123776091) has the molecular formula C26H33FN8O2S and a molecular weight of 540.67 g/mol. Its IUPAC name is N-butyl-N-[5-[4-[2-(3,3-dihydrazinylprop-2-enylideneamino)ethoxy]-3,5-dimethylphenyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide.
| Compound Name | N-butyl-N-[5-[4-[2-(3,3-dihydrazinylprop-2-enylideneamino)ethoxy]-3,5-dimethylphenyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 123776091 |
| Molecular Formula | C26H33FN8O2S |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | N-butyl-N-[5-[4-[2-(3,3-dihydrazinylprop-2-enylideneamino)ethoxy]-3,5-dimethylphenyl]-1,3,4-thiadiazol-2-yl]-2-fluorobenzamide |
| SMILES | CCCCN(C(=O)c1ccccc1F)c1nnc(-c2cc(C)c(OCC/N=C/C=C(NN)NN)c(C)c2)s1 |
| InChI | InChI=1S/C26H33FN8O2S/c1-4-5-13-35(25(36)20-8-6-7-9-21(20)27)26-34-33-24(38-26)19-15-17(2)23(18(3)16-19)37-14-12-30-11-10-22(31-28)32-29/h6-11,15-16,31-32H,4-5,12-14,28-29H2,1-3H3/b30-11+ |
| InChIKey | UJQZCZATGYVIOH-KNBZMSCYSA-N |
| XLogP | 3.63 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|