C22H21ClFN3O2S — CID 58390915
N-butyl-3-chloro-2-fluoro-N-[5-(4-formyl-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 58390915) has the molecular formula C22H21ClFN3O2S and a molecular weight of 445.95 g/mol. Its IUPAC name is N-butyl-3-chloro-2-fluoro-N-[5-(4-formyl-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-butyl-3-chloro-2-fluoro-N-[5-(4-formyl-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 58390915 |
| Molecular Formula | C22H21ClFN3O2S |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-butyl-3-chloro-2-fluoro-N-[5-(4-formyl-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCN(C(=O)c1cccc(Cl)c1F)c1nnc(-c2cc(C)c(C=O)c(C)c2)s1 |
| InChI | InChI=1S/C22H21ClFN3O2S/c1-4-5-9-27(21(29)16-7-6-8-18(23)19(16)24)22-26-25-20(30-22)15-10-13(2)17(12-28)14(3)11-15/h6-8,10-12H,4-5,9H2,1-3H3 |
| InChIKey | KWZVQWRTJPLKBX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|