C20H19N3O2S — CID 58390901
N-butyl-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 58390901) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-butyl-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-butyl-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 58390901 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-butyl-N-[5-(4-formylphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCCCN(C(=O)c1ccccc1)c1nnc(-c2ccc(C=O)cc2)s1 |
| InChI | InChI=1S/C20H19N3O2S/c1-2-3-13-23(19(25)17-7-5-4-6-8-17)20-22-21-18(26-20)16-11-9-15(14-24)10-12-16/h4-12,14H,2-3,13H2,1H3 |
| InChIKey | SIPFLKVKKZIBMR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|