C9H10O4 — CID 87549008
2-(2,3-dihydroxy-4-methoxyphenyl)acetaldehyde (PubChem CID 87549008) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 2-(2,3-dihydroxy-4-methoxyphenyl)acetaldehyde.
| Compound Name | 2-(2,3-dihydroxy-4-methoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 87549008 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-(2,3-dihydroxy-4-methoxyphenyl)acetaldehyde |
| SMILES | COc1ccc(CC=O)c(O)c1O |
| InChI | InChI=1S/C9H10O4/c1-13-7-3-2-6(4-5-10)8(11)9(7)12/h2-3,5,11-12H,4H2,1H3 |
| InChIKey | TUVUHSRTWMUHMB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|