C13H17N3OS — CID 87549749
morpholine;4-phenyl-1,3-dihydroimidazole-2-thione (PubChem CID 87549749) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is morpholine;4-phenyl-1,3-dihydroimidazole-2-thione.
| Compound Name | morpholine;4-phenyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 87549749 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | morpholine;4-phenyl-1,3-dihydroimidazole-2-thione |
| SMILES | C1COCCN1.S=c1[nH]cc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C9H8N2S.C4H9NO/c12-9-10-6-8(11-9)7-4-2-1-3-5-7;1-3-6-4-2-5-1/h1-6H,(H2,10,11,12);5H,1-4H2 |
| InChIKey | LCELQPPNFBXUBU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|