C21H26N2O3S — CID 87549838
4-octan-3-yl-2-phenyl-1H-benzimidazole-5-sulfonic acid (PubChem CID 87549838) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-octan-3-yl-2-phenyl-1H-benzimidazole-5-sulfonic acid.
| Compound Name | 4-octan-3-yl-2-phenyl-1H-benzimidazole-5-sulfonic acid |
|---|---|
| PubChem CID | 87549838 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-octan-3-yl-2-phenyl-1H-benzimidazole-5-sulfonic acid |
| SMILES | CCCCCC(CC)c1c(S(=O)(=O)O)ccc2[nH]c(-c3ccccc3)nc12 |
| InChI | InChI=1S/C21H26N2O3S/c1-3-5-7-10-15(4-2)19-18(27(24,25)26)14-13-17-20(19)23-21(22-17)16-11-8-6-9-12-16/h6,8-9,11-15H,3-5,7,10H2,1-2H3,(H,22,23)(H,24,25,26) |
| InChIKey | JJUJTQBPMJRQAB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|