C19H20ClN5O2 — CID 87549842
2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-pyrazolo[4,3-b]pyridin-2-ylacetaldehyde (PubChem CID 87549842) has the molecular formula C19H20ClN5O2 and a molecular weight of 385.86 g/mol. Its IUPAC name is 2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-pyrazolo[4,3-b]pyridin-2-ylacetaldehyde.
| Compound Name | 2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-pyrazolo[4,3-b]pyridin-2-ylacetaldehyde |
|---|---|
| PubChem CID | 87549842 |
| Molecular Formula | C19H20ClN5O2 |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-[4-(4-chloro-3-methoxyphenyl)piperazin-1-yl]-2-pyrazolo[4,3-b]pyridin-2-ylacetaldehyde |
| SMILES | COc1cc(N2CCN(C(C=O)n3cc4ncccc4n3)CC2)ccc1Cl |
| InChI | InChI=1S/C19H20ClN5O2/c1-27-18-11-14(4-5-15(18)20)23-7-9-24(10-8-23)19(13-26)25-12-17-16(22-25)3-2-6-21-17/h2-6,11-13,19H,7-10H2,1H3 |
| InChIKey | AKJDIGCWMKUMCM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|