C27H21N9 — CID 87550137
4-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine (PubChem CID 87550137) has the molecular formula C27H21N9 and a molecular weight of 471.53 g/mol. Its IUPAC name is 4-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine.
| Compound Name | 4-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine |
|---|---|
| PubChem CID | 87550137 |
| Molecular Formula | C27H21N9 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 4-(3-ethynylphenyl)-7-methyl-8-[3-(7H-purin-6-yl)-2-pyridinyl]quinazoline;hydrazine |
| SMILES | C#Cc1cccc(-c2ncnc3c(-c4ncccc4-c4ncnc5nc[nH]c45)c(C)ccc23)c1.NN |
| InChI | InChI=1S/C27H17N7.H4N2/c1-3-17-6-4-7-18(12-17)22-20-10-9-16(2)21(24(20)30-13-29-22)23-19(8-5-11-28-23)25-26-27(33-14-31-25)34-15-32-26;1-2/h1,4-15H,2H3,(H,31,32,33,34);1-2H2 |
| InChIKey | FUORSNQQBHYPQK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|