C37H38N4O5 — CID 87550281
2-[[6-[[formyl(hydroxy)amino]-[1-(4-methylphenyl)propan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]-6-phenylbenzoic acid (PubChem CID 87550281) has the molecular formula C37H38N4O5 and a molecular weight of 618.73 g/mol. Its IUPAC name is 2-[[6-[[formyl(hydroxy)amino]-[1-(4-methylphenyl)propan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]-6-phenylbenzoic acid.
| Compound Name | 2-[[6-[[formyl(hydroxy)amino]-[1-(4-methylphenyl)propan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]-6-phenylbenzoic acid |
|---|---|
| PubChem CID | 87550281 |
| Molecular Formula | C37H38N4O5 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 2-[[6-[[formyl(hydroxy)amino]-[1-(4-methylphenyl)propan-2-yl]carbamoyl]-4-methyl-2-propylbenzimidazol-1-yl]methyl]-6-phenylbenzoic acid |
| SMILES | CCCc1nc2c(C)cc(C(=O)N(C(C)Cc3ccc(C)cc3)N(O)C=O)cc2n1Cc1cccc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C37H38N4O5/c1-5-10-33-38-35-25(3)19-30(36(43)41(40(46)23-42)26(4)20-27-17-15-24(2)16-18-27)21-32(35)39(33)22-29-13-9-14-31(34(29)37(44)45)28-11-7-6-8-12-28/h6-9,11-19,21,23,26,46H,5,10,20,22H2,1-4H3,(H,44,45) |
| InChIKey | BDVVYAIKHPEUHD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|