C28H28N2O4 — CID 67878319
2-[[5-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]-2-phenylphenyl]methyl]propanedioic acid (PubChem CID 67878319) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[[5-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]-2-phenylphenyl]methyl]propanedioic acid.
| Compound Name | 2-[[5-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]-2-phenylphenyl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 67878319 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[[5-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]-2-phenylphenyl]methyl]propanedioic acid |
| SMILES | CCCc1nc2c(C)cccc2n1Cc1ccc(-c2ccccc2)c(CC(C(=O)O)C(=O)O)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-3-8-25-29-26-18(2)9-7-12-24(26)30(25)17-19-13-14-22(20-10-5-4-6-11-20)21(15-19)16-23(27(31)32)28(33)34/h4-7,9-15,23H,3,8,16-17H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | IAODIDOJQJIZFD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|