C30H38N3O3P — CID 22407333
N-[diethoxyphosphoryl(phenyl)methyl]-N-methyl-4-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]aniline (PubChem CID 22407333) has the molecular formula C30H38N3O3P and a molecular weight of 519.63 g/mol. Its IUPAC name is N-[diethoxyphosphoryl(phenyl)methyl]-N-methyl-4-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]aniline.
| Compound Name | N-[diethoxyphosphoryl(phenyl)methyl]-N-methyl-4-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 22407333 |
| Molecular Formula | C30H38N3O3P |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | N-[diethoxyphosphoryl(phenyl)methyl]-N-methyl-4-[(4-methyl-2-propylbenzimidazol-1-yl)methyl]aniline |
| SMILES | CCCc1nc2c(C)cccc2n1Cc1ccc(N(C)C(c2ccccc2)P(=O)(OCC)OCC)cc1 |
| InChI | InChI=1S/C30H38N3O3P/c1-6-13-28-31-29-23(4)14-12-17-27(29)33(28)22-24-18-20-26(21-19-24)32(5)30(25-15-10-9-11-16-25)37(34,35-7-2)36-8-3/h9-12,14-21,30H,6-8,13,22H2,1-5H3 |
| InChIKey | XCWDAQJRAPHDAY-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|