C16H16N2 — CID 14933027
1-benzyl-2,4-dimethylbenzimidazole (PubChem CID 14933027) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-benzyl-2,4-dimethylbenzimidazole.
| Compound Name | 1-benzyl-2,4-dimethylbenzimidazole |
|---|---|
| PubChem CID | 14933027 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-benzyl-2,4-dimethylbenzimidazole |
| SMILES | Cc1cccc2c1nc(C)n2Cc1ccccc1 |
| InChI | InChI=1S/C16H16N2/c1-12-7-6-10-15-16(12)17-13(2)18(15)11-14-8-4-3-5-9-14/h3-10H,11H2,1-2H3 |
| InChIKey | MNAFTEIMLMQFOS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |