C19H26N2 — CID 54159147
1-(3,7-dimethylocta-2,6-dienyl)-2,4-dimethylbenzimidazole (PubChem CID 54159147) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(3,7-dimethylocta-2,6-dienyl)-2,4-dimethylbenzimidazole.
| Compound Name | 1-(3,7-dimethylocta-2,6-dienyl)-2,4-dimethylbenzimidazole |
|---|---|
| PubChem CID | 54159147 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-(3,7-dimethylocta-2,6-dienyl)-2,4-dimethylbenzimidazole |
| SMILES | CC(C)=CCCC(C)=CCn1c(C)nc2c(C)cccc21 |
| InChI | InChI=1S/C19H26N2/c1-14(2)8-6-9-15(3)12-13-21-17(5)20-19-16(4)10-7-11-18(19)21/h7-8,10-12H,6,9,13H2,1-5H3 |
| InChIKey | ONEUSVNDOCKUMP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|