C26H26N2O4 — CID 162821003
5-(3,7-dimethylocta-2,6-dienyl)-3-methyl-2-oxofuro[2,3-b]phenazine-11-carboxylic acid (PubChem CID 162821003) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 5-(3,7-dimethylocta-2,6-dienyl)-3-methyl-2-oxofuro[2,3-b]phenazine-11-carboxylic acid.
| Compound Name | 5-(3,7-dimethylocta-2,6-dienyl)-3-methyl-2-oxofuro[2,3-b]phenazine-11-carboxylic acid |
|---|---|
| PubChem CID | 162821003 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5-(3,7-dimethylocta-2,6-dienyl)-3-methyl-2-oxofuro[2,3-b]phenazine-11-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCn1c2ccccc2nc2c(C(=O)O)c3oc(=O)c(C)c3cc21 |
| InChI | InChI=1S/C26H26N2O4/c1-15(2)8-7-9-16(3)12-13-28-20-11-6-5-10-19(20)27-23-21(28)14-18-17(4)26(31)32-24(18)22(23)25(29)30/h5-6,8,10-12,14H,7,9,13H2,1-4H3,(H,29,30) |
| InChIKey | DRTHRWYJKFGBCU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|