C30H37NO2 — CID 123769442
1,2-dimethyl-4-(4,8,12-trimethyltrideca-3,7,11-trienyl)phenoxazin-3-one (PubChem CID 123769442) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is 1,2-dimethyl-4-(4,8,12-trimethyltrideca-3,7,11-trienyl)phenoxazin-3-one.
| Compound Name | 1,2-dimethyl-4-(4,8,12-trimethyltrideca-3,7,11-trienyl)phenoxazin-3-one |
|---|---|
| PubChem CID | 123769442 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 1,2-dimethyl-4-(4,8,12-trimethyltrideca-3,7,11-trienyl)phenoxazin-3-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCc1c2oc3ccccc3nc-2c(C)c(C)c1=O |
| InChI | InChI=1S/C30H37NO2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-25-29(32)24(6)23(5)28-30(25)33-27-19-8-7-18-26(27)31-28/h7-8,12,14,16,18-19H,9-11,13,15,17H2,1-6H3 |
| InChIKey | NRUPIKCKRUEPSG-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|