C21H26O4 — CID 163043900
(2S,5E)-2-(5-hydroxy-1-benzofuran-2-yl)-6,10-dimethylundeca-5,9-dienoic acid (PubChem CID 163043900) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2S,5E)-2-(5-hydroxy-1-benzofuran-2-yl)-6,10-dimethylundeca-5,9-dienoic acid.
| Compound Name | (2S,5E)-2-(5-hydroxy-1-benzofuran-2-yl)-6,10-dimethylundeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 163043900 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2S,5E)-2-(5-hydroxy-1-benzofuran-2-yl)-6,10-dimethylundeca-5,9-dienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@H](C(=O)O)c1cc2cc(O)ccc2o1 |
| InChI | InChI=1S/C21H26O4/c1-14(2)6-4-7-15(3)8-5-9-18(21(23)24)20-13-16-12-17(22)10-11-19(16)25-20/h6,8,10-13,18,22H,4-5,7,9H2,1-3H3,(H,23,24)/b15-8+/t18-/m0/s1 |
| InChIKey | XZFXVBWSDABZIS-KWJIGKFDSA-N |
| XLogP | 5.78 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|