C24H34O3 — CID 154075811
2-(7,11-dimethyldodeca-6,10-dien-3-yl)-5,6-dimethoxy-1-benzofuran (PubChem CID 154075811) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 2-(7,11-dimethyldodeca-6,10-dien-3-yl)-5,6-dimethoxy-1-benzofuran.
| Compound Name | 2-(7,11-dimethyldodeca-6,10-dien-3-yl)-5,6-dimethoxy-1-benzofuran |
|---|---|
| PubChem CID | 154075811 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-(7,11-dimethyldodeca-6,10-dien-3-yl)-5,6-dimethoxy-1-benzofuran |
| SMILES | CCC(CCC=C(C)CCC=C(C)C)c1cc2cc(OC)c(OC)cc2o1 |
| InChI | InChI=1S/C24H34O3/c1-7-19(13-9-12-18(4)11-8-10-17(2)3)21-14-20-15-23(25-5)24(26-6)16-22(20)27-21/h10,12,14-16,19H,7-9,11,13H2,1-6H3 |
| InChIKey | NWFFHJHUVUTASR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|