C16H24O3 — CID 10934350
4,5-dimethoxy-2-(6-methylhept-5-en-2-yl)phenol (PubChem CID 10934350) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4,5-dimethoxy-2-(6-methylhept-5-en-2-yl)phenol.
| Compound Name | 4,5-dimethoxy-2-(6-methylhept-5-en-2-yl)phenol |
|---|---|
| PubChem CID | 10934350 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 4,5-dimethoxy-2-(6-methylhept-5-en-2-yl)phenol |
| SMILES | COc1cc(O)c(C(C)CCC=C(C)C)cc1OC |
| InChI | InChI=1S/C16H24O3/c1-11(2)7-6-8-12(3)13-9-15(18-4)16(19-5)10-14(13)17/h7,9-10,12,17H,6,8H2,1-5H3 |
| InChIKey | DBANSLRLXWXKRN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|