C42H46N2 — CID 144783648
6,18-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene (PubChem CID 144783648) has the molecular formula C42H46N2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 6,18-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene.
| Compound Name | 6,18-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
|---|---|
| PubChem CID | 144783648 |
| Molecular Formula | C42H46N2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 6,18-bis[(2E)-3,7-dimethylocta-2,6-dienyl]-6,18-diazahexacyclo[11.11.0.02,10.05,9.014,22.017,21]tetracosa-1(13),2(10),3,5(9),7,11,14(22),15,17(21),19,23-undecaene |
| SMILES | CC(C)=CCC/C(C)=C/Cn1ccc2c3ccc4c(ccc5c4ccc4c5ccn4C/C=C(\C)CCC=C(C)C)c3ccc21 |
| InChI | InChI=1S/C42H46N2/c1-29(2)9-7-11-31(5)21-25-43-27-23-39-37-15-13-34-33(35(37)17-19-41(39)43)14-16-38-36(34)18-20-42-40(38)24-28-44(42)26-22-32(6)12-8-10-30(3)4/h9-10,13-24,27-28H,7-8,11-12,25-26H2,1-6H3/b31-21+,32-22+ |
| InChIKey | KQKPPCIZZGMZHZ-RWRHWQIFSA-N |
| XLogP | 12.44 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|