C19H27FN2O2 — CID 118270959
5-fluoro-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrimidine-2,4-dione (PubChem CID 118270959) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 5-fluoro-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118270959 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 5-fluoro-1-(3,7,11-trimethyldodeca-2,6,10-trienyl)pyrimidine-2,4-dione |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H27FN2O2/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-22-13-17(20)18(23)21-19(22)24/h7,9,11,13H,5-6,8,10,12H2,1-4H3,(H,21,23,24) |
| InChIKey | MZHMIONMCDPGOF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|