C17H26N4O2 — CID 67735414
9-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyl-8H-purine-2,6-dione (PubChem CID 67735414) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 9-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyl-8H-purine-2,6-dione.
| Compound Name | 9-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyl-8H-purine-2,6-dione |
|---|---|
| PubChem CID | 67735414 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 9-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,7-dimethyl-8H-purine-2,6-dione |
| SMILES | CC(C)=CCC/C(C)=C/CN1CN(C)c2c1n(C)c(=O)[nH]c2=O |
| InChI | InChI=1S/C17H26N4O2/c1-12(2)7-6-8-13(3)9-10-21-11-19(4)14-15(22)18-17(23)20(5)16(14)21/h7,9H,6,8,10-11H2,1-5H3,(H,18,22,23)/b13-9+ |
| InChIKey | BVOPECBIZYSMSK-UKTHLTGXSA-N |
| XLogP | 1.98 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|