C18H30N2O — CID 171146682
(3aR,7aS)-2-(3,7-dimethylocta-2,6-dienyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 171146682) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (3aR,7aS)-2-(3,7-dimethylocta-2,6-dienyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-2-(3,7-dimethylocta-2,6-dienyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 171146682 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (3aR,7aS)-2-(3,7-dimethylocta-2,6-dienyl)-5-methyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | CC(C)=CCCC(C)=CCN1C[C@H]2CCN(C)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C18H30N2O/c1-14(2)6-5-7-15(3)8-11-20-12-16-9-10-19(4)18(21)17(16)13-20/h6,8,16-17H,5,7,9-13H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | ULBNKNLIMFBXTA-SJORKVTESA-N |
| XLogP | 3.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|