C29H49BrN2O — CID 54408686
1-[1-(3-bromopropyl)-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone (PubChem CID 54408686) has the molecular formula C29H49BrN2O and a molecular weight of 521.63 g/mol. Its IUPAC name is 1-[1-(3-bromopropyl)-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone.
| Compound Name | 1-[1-(3-bromopropyl)-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 54408686 |
| Molecular Formula | C29H49BrN2O |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 1-[1-(3-bromopropyl)-4-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CN(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)CCN1CCCBr |
| InChI | InChI=1S/C29H49BrN2O/c1-24(2)11-7-12-25(3)13-8-14-26(4)15-9-16-27(5)17-20-31-21-22-32(19-10-18-30)29(23-31)28(6)33/h11,13,15,17,29H,7-10,12,14,16,18-23H2,1-6H3 |
| InChIKey | VSOGWPDOVTZXEX-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|