C29H50N2O — CID 54509820
1-[3-propyl-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone (PubChem CID 54509820) has the molecular formula C29H50N2O and a molecular weight of 442.73 g/mol. Its IUPAC name is 1-[3-propyl-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone.
| Compound Name | 1-[3-propyl-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 54509820 |
| Molecular Formula | C29H50N2O |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | 1-[3-propyl-1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)piperazin-2-yl]ethanone |
| SMILES | CCCC1NCCN(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C1C(C)=O |
| InChI | InChI=1S/C29H50N2O/c1-8-12-28-29(27(7)32)31(22-20-30-28)21-19-26(6)18-11-17-25(5)16-10-15-24(4)14-9-13-23(2)3/h13,15,17,19,28-30H,8-12,14,16,18,20-22H2,1-7H3 |
| InChIKey | YIHQSOMVWUIDMQ-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|