2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid

C17H28O2 — CID 173450762

IUPAC2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid
SMILESCCC(C(=O)O)=C(C)CCC=C(C)CCC=C(C)C
InChIInChI=1S/C17H28O2/c1-6-16(17(18)19)15(5)12-8-11-14(4)10-7-9-13(2)3/h9,11H,6-8,10,12H2,1-5H3,(H,18,19)
InChIKeyGEFWMDDJDJYETL-UHFFFAOYSA-N
MW264.41 g/mol
LogP5.27
Rot. Bonds8

About 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid

2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid (PubChem CID 173450762) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid.

Molecular Properties

Compound Name2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid
PubChem CID173450762
Molecular FormulaC17H28O2
Molecular Weight264.41 g/mol
Exact Mass264.21
IUPAC Name2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid
SMILESCCC(C(=O)O)=C(C)CCC=C(C)CCC=C(C)C
InChIInChI=1S/C17H28O2/c1-6-16(17(18)19)15(5)12-8-11-14(4)10-7-9-13(2)3/h9,11H,6-8,10,12H2,1-5H3,(H,18,19)
InChIKeyGEFWMDDJDJYETL-UHFFFAOYSA-N
XLogP5.27
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500264.41
LogP ≤ 55.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid?
The IUPAC name of 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid (CID 173450762) is 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid.
What is the SMILES notation for 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid?
The canonical SMILES for 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid is CCC(C(=O)O)=C(C)CCC=C(C)CCC=C(C)C.
What is the InChIKey of 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid?
The InChIKey is GEFWMDDJDJYETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-6-16(17(18)19)15(5)12-8-11-14(4)10-7-9-13(2)3/h9,11H,6-8,10,12H2,1-5H3,(H,18,19).
What are the key properties of 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid?
2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid has a molecular weight of 264.41 g/mol, XLogP of 5.27, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,7,11-trimethyldodeca-2,6,10-trienoic acid is sourced from PubChem (CID 173450762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).